C12H12FIN2O2 — CID 166609541
methyl 2-amino-3-(4-fluoro-5-iodo-1H-indol-3-yl)propanoate (PubChem CID 166609541) has the molecular formula C12H12FIN2O2 and a molecular weight of 362.14 g/mol. Its IUPAC name is methyl 2-amino-3-(4-fluoro-5-iodo-1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-amino-3-(4-fluoro-5-iodo-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 166609541 |
| Molecular Formula | C12H12FIN2O2 |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | methyl 2-amino-3-(4-fluoro-5-iodo-1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(N)Cc1c[nH]c2ccc(I)c(F)c12 |
| InChI | InChI=1S/C12H12FIN2O2/c1-18-12(17)8(15)4-6-5-16-9-3-2-7(14)11(13)10(6)9/h2-3,5,8,16H,4,15H2,1H3 |
| InChIKey | KEDBFGOBLOCYCP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|