C11H12F2INO3 — CID 177062658
methyl 2-amino-3-(2,4-difluoro-5-iodo-3-methoxyphenyl)propanoate (PubChem CID 177062658) has the molecular formula C11H12F2INO3 and a molecular weight of 371.12 g/mol. Its IUPAC name is methyl 2-amino-3-(2,4-difluoro-5-iodo-3-methoxyphenyl)propanoate.
| Compound Name | methyl 2-amino-3-(2,4-difluoro-5-iodo-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 177062658 |
| Molecular Formula | C11H12F2INO3 |
| Molecular Weight | 371.12 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | methyl 2-amino-3-(2,4-difluoro-5-iodo-3-methoxyphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1cc(I)c(F)c(OC)c1F |
| InChI | InChI=1S/C11H12F2INO3/c1-17-10-8(12)5(3-6(14)9(10)13)4-7(15)11(16)18-2/h3,7H,4,15H2,1-2H3 |
| InChIKey | NRXAPCPVANVSPX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|