C10H10Br2FNO3 — CID 170884170
methyl 2-amino-3-(3,5-dibromo-4-fluoro-2-hydroxyphenyl)propanoate (PubChem CID 170884170) has the molecular formula C10H10Br2FNO3 and a molecular weight of 371.00 g/mol. Its IUPAC name is methyl 2-amino-3-(3,5-dibromo-4-fluoro-2-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-amino-3-(3,5-dibromo-4-fluoro-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 170884170 |
| Molecular Formula | C10H10Br2FNO3 |
| Molecular Weight | 371.00 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | methyl 2-amino-3-(3,5-dibromo-4-fluoro-2-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1cc(Br)c(F)c(Br)c1O |
| InChI | InChI=1S/C10H10Br2FNO3/c1-17-10(16)6(14)3-4-2-5(11)8(13)7(12)9(4)15/h2,6,15H,3,14H2,1H3 |
| InChIKey | QCSFEHIFKQILHQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.00 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|