C9H9BrClF2NO3 — CID 136574243
2-amino-3-(5-bromo-2,3-difluoro-4-hydroxyphenyl)propanoic acid;hydrochloride (PubChem CID 136574243) has the molecular formula C9H9BrClF2NO3 and a molecular weight of 332.53 g/mol. Its IUPAC name is 2-amino-3-(5-bromo-2,3-difluoro-4-hydroxyphenyl)propanoic acid;hydrochloride.
| Compound Name | 2-amino-3-(5-bromo-2,3-difluoro-4-hydroxyphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 136574243 |
| Molecular Formula | C9H9BrClF2NO3 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 2-amino-3-(5-bromo-2,3-difluoro-4-hydroxyphenyl)propanoic acid;hydrochloride |
| SMILES | Cl.NC(Cc1cc(Br)c(O)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C9H8BrF2NO3.ClH/c10-4-1-3(2-5(13)9(15)16)6(11)7(12)8(4)14;/h1,5,14H,2,13H2,(H,15,16);1H |
| InChIKey | OPPNBZNLMKXUOT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|