C9H9I2NO3 — CID 142647558
2-amino-3-(2-hydroxy-3,5-diiodophenyl)propanoic acid (PubChem CID 142647558) has the molecular formula C9H9I2NO3 and a molecular weight of 432.98 g/mol. Its IUPAC name is 2-amino-3-(2-hydroxy-3,5-diiodophenyl)propanoic acid.
| Compound Name | 2-amino-3-(2-hydroxy-3,5-diiodophenyl)propanoic acid |
|---|---|
| PubChem CID | 142647558 |
| Molecular Formula | C9H9I2NO3 |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.87 |
| IUPAC Name | 2-amino-3-(2-hydroxy-3,5-diiodophenyl)propanoic acid |
| SMILES | NC(Cc1cc(I)cc(I)c1O)C(=O)O |
| InChI | InChI=1S/C9H9I2NO3/c10-5-1-4(2-7(12)9(14)15)8(13)6(11)3-5/h1,3,7,13H,2,12H2,(H,14,15) |
| InChIKey | TVRVXPKYIHFLGT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|