C10H13I2NO — CID 131060638
2-(2-aminobutyl)-4,6-diiodophenol (PubChem CID 131060638) has the molecular formula C10H13I2NO and a molecular weight of 417.03 g/mol. Its IUPAC name is 2-(2-aminobutyl)-4,6-diiodophenol.
| Compound Name | 2-(2-aminobutyl)-4,6-diiodophenol |
|---|---|
| PubChem CID | 131060638 |
| Molecular Formula | C10H13I2NO |
| Molecular Weight | 417.03 g/mol |
| Exact Mass | 416.91 |
| IUPAC Name | 2-(2-aminobutyl)-4,6-diiodophenol |
| SMILES | CCC(N)Cc1cc(I)cc(I)c1O |
| InChI | InChI=1S/C10H13I2NO/c1-2-8(13)4-6-3-7(11)5-9(12)10(6)14/h3,5,8,14H,2,4,13H2,1H3 |
| InChIKey | UTLSMROUTLPSSP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.03 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|