C9H11I2NO — CID 130693520
2-(ethylaminomethyl)-4,6-diiodophenol (PubChem CID 130693520) has the molecular formula C9H11I2NO and a molecular weight of 403.00 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-4,6-diiodophenol.
| Compound Name | 2-(ethylaminomethyl)-4,6-diiodophenol |
|---|---|
| PubChem CID | 130693520 |
| Molecular Formula | C9H11I2NO |
| Molecular Weight | 403.00 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 2-(ethylaminomethyl)-4,6-diiodophenol |
| SMILES | CCNCc1cc(I)cc(I)c1O |
| InChI | InChI=1S/C9H11I2NO/c1-2-12-5-6-3-7(10)4-8(11)9(6)13/h3-4,12-13H,2,5H2,1H3 |
| InChIKey | SJLJPDONLQOFOQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.00 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|