About 2-(ethylaminomethyl)-4,6-diiodophenol
2-(ethylaminomethyl)-4,6-diiodophenol (PubChem CID 130693520) has the molecular formula C9H11I2NO
and a molecular weight of 403.00 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-4,6-diiodophenol.
Molecular Properties
| Compound Name | 2-(ethylaminomethyl)-4,6-diiodophenol |
| PubChem CID | 130693520 |
| Molecular Formula | C9H11I2NO |
| Molecular Weight | 403.00 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 2-(ethylaminomethyl)-4,6-diiodophenol |
| SMILES | CCNCc1cc(I)cc(I)c1O |
| InChI | InChI=1S/C9H11I2NO/c1-2-12-5-6-3-7(10)4-8(11)9(6)13/h3-4,12-13H,2,5H2,1H3 |
| InChIKey | SJLJPDONLQOFOQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.00 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylaminomethyl)-4,6-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylaminomethyl)-4,6-diiodophenol?
The IUPAC name of 2-(ethylaminomethyl)-4,6-diiodophenol (CID 130693520) is 2-(ethylaminomethyl)-4,6-diiodophenol.
What is the SMILES notation for 2-(ethylaminomethyl)-4,6-diiodophenol?
The canonical SMILES for 2-(ethylaminomethyl)-4,6-diiodophenol is CCNCc1cc(I)cc(I)c1O.
What is the InChIKey of 2-(ethylaminomethyl)-4,6-diiodophenol?
The InChIKey is SJLJPDONLQOFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11I2NO/c1-2-12-5-6-3-7(10)4-8(11)9(6)13/h3-4,12-13H,2,5H2,1H3.
What are the key properties of 2-(ethylaminomethyl)-4,6-diiodophenol?
2-(ethylaminomethyl)-4,6-diiodophenol has a molecular weight of 403.00 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylaminomethyl)-4,6-diiodophenol is sourced from PubChem (CID 130693520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).