C15H15I2NO2 — CID 122695013
2-[(5-ethyl-2-hydroxyanilino)methyl]-4,6-diiodophenol (PubChem CID 122695013) has the molecular formula C15H15I2NO2 and a molecular weight of 495.10 g/mol. Its IUPAC name is 2-[(5-ethyl-2-hydroxyanilino)methyl]-4,6-diiodophenol.
| Compound Name | 2-[(5-ethyl-2-hydroxyanilino)methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 122695013 |
| Molecular Formula | C15H15I2NO2 |
| Molecular Weight | 495.10 g/mol |
| Exact Mass | 494.92 |
| IUPAC Name | 2-[(5-ethyl-2-hydroxyanilino)methyl]-4,6-diiodophenol |
| SMILES | CCc1ccc(O)c(NCc2cc(I)cc(I)c2O)c1 |
| InChI | InChI=1S/C15H15I2NO2/c1-2-9-3-4-14(19)13(5-9)18-8-10-6-11(16)7-12(17)15(10)20/h3-7,18-20H,2,8H2,1H3 |
| InChIKey | QORKKKPJEDXSSH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.10 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|