C17H13I2NO3 — CID 71589289
7-[(2-hydroxy-3,5-diiodophenyl)methylamino]-4-methylchromen-2-one (PubChem CID 71589289) has the molecular formula C17H13I2NO3 and a molecular weight of 533.10 g/mol. Its IUPAC name is 7-[(2-hydroxy-3,5-diiodophenyl)methylamino]-4-methylchromen-2-one.
| Compound Name | 7-[(2-hydroxy-3,5-diiodophenyl)methylamino]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 71589289 |
| Molecular Formula | C17H13I2NO3 |
| Molecular Weight | 533.10 g/mol |
| Exact Mass | 532.90 |
| IUPAC Name | 7-[(2-hydroxy-3,5-diiodophenyl)methylamino]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(NCc3cc(I)cc(I)c3O)ccc12 |
| InChI | InChI=1S/C17H13I2NO3/c1-9-4-16(21)23-15-7-12(2-3-13(9)15)20-8-10-5-11(18)6-14(19)17(10)22/h2-7,20,22H,8H2,1H3 |
| InChIKey | XRPSNNUJFUPLBC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|