C14H13N3O3 — CID 43074577
4-methyl-7-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]chromen-2-one (PubChem CID 43074577) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-methyl-7-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]chromen-2-one.
| Compound Name | 4-methyl-7-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]chromen-2-one |
|---|---|
| PubChem CID | 43074577 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-methyl-7-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]chromen-2-one |
| SMILES | Cc1noc(CNc2ccc3c(C)cc(=O)oc3c2)n1 |
| InChI | InChI=1S/C14H13N3O3/c1-8-5-14(18)19-12-6-10(3-4-11(8)12)15-7-13-16-9(2)17-20-13/h3-6,15H,7H2,1-2H3 |
| InChIKey | UGOFMFBYHQHEAG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|