C17H27I2N3O — CID 124863844
2,4-diiodo-6-[[[(2S)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]amino]methyl]phenol (PubChem CID 124863844) has the molecular formula C17H27I2N3O and a molecular weight of 543.23 g/mol. Its IUPAC name is 2,4-diiodo-6-[[[(2S)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]amino]methyl]phenol.
| Compound Name | 2,4-diiodo-6-[[[(2S)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 124863844 |
| Molecular Formula | C17H27I2N3O |
| Molecular Weight | 543.23 g/mol |
| Exact Mass | 543.02 |
| IUPAC Name | 2,4-diiodo-6-[[[(2S)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]amino]methyl]phenol |
| SMILES | CC(C)[C@@H](CNCc1cc(I)cc(I)c1O)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H27I2N3O/c1-12(2)16(22-6-4-21(3)5-7-22)11-20-10-13-8-14(18)9-15(19)17(13)23/h8-9,12,16,20,23H,4-7,10-11H2,1-3H3/t16-/m1/s1 |
| InChIKey | UTFHZDJOUFWUBK-MRXNPFEDSA-N |
| XLogP | 2.96 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|