C18H31N3 — CID 60760102
3-methyl-N-[(3-methylphenyl)methyl]-2-(4-methylpiperazin-1-yl)butan-1-amine (PubChem CID 60760102) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 3-methyl-N-[(3-methylphenyl)methyl]-2-(4-methylpiperazin-1-yl)butan-1-amine.
| Compound Name | 3-methyl-N-[(3-methylphenyl)methyl]-2-(4-methylpiperazin-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 60760102 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 3-methyl-N-[(3-methylphenyl)methyl]-2-(4-methylpiperazin-1-yl)butan-1-amine |
| SMILES | Cc1cccc(CNCC(C(C)C)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C18H31N3/c1-15(2)18(21-10-8-20(4)9-11-21)14-19-13-17-7-5-6-16(3)12-17/h5-7,12,15,18-19H,8-11,13-14H2,1-4H3 |
| InChIKey | VMTOYPQHSPQEQJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |