C17H29N3O2S — CID 94249189
3-methyl-N-[(2S)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide (PubChem CID 94249189) has the molecular formula C17H29N3O2S and a molecular weight of 339.50 g/mol. Its IUPAC name is 3-methyl-N-[(2S)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[(2S)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 94249189 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 3-methyl-N-[(2S)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NC[C@H](C(C)C)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C17H29N3O2S/c1-14(2)17(20-10-8-19(4)9-11-20)13-18-23(21,22)16-7-5-6-15(3)12-16/h5-7,12,14,17-18H,8-11,13H2,1-4H3/t17-/m1/s1 |
| InChIKey | KOBNJVYMQMNZIB-QGZVFWFLSA-N |
| XLogP | 1.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |