C17H28ClN3O2S — CID 110403737
3-chloro-N-[4-methyl-2-(4-methylpiperazin-1-yl)pentyl]benzenesulfonamide (PubChem CID 110403737) has the molecular formula C17H28ClN3O2S and a molecular weight of 373.95 g/mol. Its IUPAC name is 3-chloro-N-[4-methyl-2-(4-methylpiperazin-1-yl)pentyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[4-methyl-2-(4-methylpiperazin-1-yl)pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110403737 |
| Molecular Formula | C17H28ClN3O2S |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-chloro-N-[4-methyl-2-(4-methylpiperazin-1-yl)pentyl]benzenesulfonamide |
| SMILES | CC(C)CC(CNS(=O)(=O)c1cccc(Cl)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H28ClN3O2S/c1-14(2)11-16(21-9-7-20(3)8-10-21)13-19-24(22,23)17-6-4-5-15(18)12-17/h4-6,12,14,16,19H,7-11,13H2,1-3H3 |
| InChIKey | WRINWARBFYIEAD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |