C16H24Cl2N2O3S — CID 46540574
2,6-dichloro-N-(4-methyl-2-morpholin-4-ylpentyl)benzenesulfonamide (PubChem CID 46540574) has the molecular formula C16H24Cl2N2O3S and a molecular weight of 395.35 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-methyl-2-morpholin-4-ylpentyl)benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-(4-methyl-2-morpholin-4-ylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46540574 |
| Molecular Formula | C16H24Cl2N2O3S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2,6-dichloro-N-(4-methyl-2-morpholin-4-ylpentyl)benzenesulfonamide |
| SMILES | CC(C)CC(CNS(=O)(=O)c1c(Cl)cccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C16H24Cl2N2O3S/c1-12(2)10-13(20-6-8-23-9-7-20)11-19-24(21,22)16-14(17)4-3-5-15(16)18/h3-5,12-13,19H,6-11H2,1-2H3 |
| InChIKey | VKIHWRCSCOWQLD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |