C16H24Cl2N2O3S — CID 110403316
3,4-dichloro-N-(4-methyl-2-morpholin-4-ylpentyl)benzenesulfonamide (PubChem CID 110403316) has the molecular formula C16H24Cl2N2O3S and a molecular weight of 395.35 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-methyl-2-morpholin-4-ylpentyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(4-methyl-2-morpholin-4-ylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110403316 |
| Molecular Formula | C16H24Cl2N2O3S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3,4-dichloro-N-(4-methyl-2-morpholin-4-ylpentyl)benzenesulfonamide |
| SMILES | CC(C)CC(CNS(=O)(=O)c1ccc(Cl)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C16H24Cl2N2O3S/c1-12(2)9-13(20-5-7-23-8-6-20)11-19-24(21,22)14-3-4-15(17)16(18)10-14/h3-4,10,12-13,19H,5-9,11H2,1-2H3 |
| InChIKey | FNCSLXPOKLHZQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |