C17H26ClFN2O3S — CID 46582731
3-chloro-N-(3-ethyl-2-morpholin-4-ylpentyl)-4-fluorobenzenesulfonamide (PubChem CID 46582731) has the molecular formula C17H26ClFN2O3S and a molecular weight of 392.92 g/mol. Its IUPAC name is 3-chloro-N-(3-ethyl-2-morpholin-4-ylpentyl)-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-(3-ethyl-2-morpholin-4-ylpentyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 46582731 |
| Molecular Formula | C17H26ClFN2O3S |
| Molecular Weight | 392.92 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-chloro-N-(3-ethyl-2-morpholin-4-ylpentyl)-4-fluorobenzenesulfonamide |
| SMILES | CCC(CC)C(CNS(=O)(=O)c1ccc(F)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C17H26ClFN2O3S/c1-3-13(4-2)17(21-7-9-24-10-8-21)12-20-25(22,23)14-5-6-16(19)15(18)11-14/h5-6,11,13,17,20H,3-4,7-10,12H2,1-2H3 |
| InChIKey | ILQVTVDXJMLKPS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.92 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |