C18H27F3N2O4S — CID 42888442
N-(3-ethyl-2-morpholin-4-ylpentyl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 42888442) has the molecular formula C18H27F3N2O4S and a molecular weight of 424.49 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 42888442 |
| Molecular Formula | C18H27F3N2O4S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCC(CC)C(CNS(=O)(=O)c1ccc(OC(F)(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H27F3N2O4S/c1-3-14(4-2)17(23-9-11-26-12-10-23)13-22-28(24,25)16-7-5-15(6-8-16)27-18(19,20)21/h5-8,14,17,22H,3-4,9-13H2,1-2H3 |
| InChIKey | RMGIYEGRMKSCSF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |