C17H24F3N3O3 — CID 86986663
1-(3-methyl-2-morpholin-4-ylbutyl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 86986663) has the molecular formula C17H24F3N3O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 1-(3-methyl-2-morpholin-4-ylbutyl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(3-methyl-2-morpholin-4-ylbutyl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 86986663 |
| Molecular Formula | C17H24F3N3O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-(3-methyl-2-morpholin-4-ylbutyl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CC(C)C(CNC(=O)Nc1ccc(OC(F)(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H24F3N3O3/c1-12(2)15(23-7-9-25-10-8-23)11-21-16(24)22-13-3-5-14(6-4-13)26-17(18,19)20/h3-6,12,15H,7-11H2,1-2H3,(H2,21,22,24) |
| InChIKey | GBQGGNOTMYYFPK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |