C21H35N3O5S — CID 55939114
(2S)-N-(3-ethyl-2-morpholin-4-ylpentyl)-2-[(4-methoxyphenyl)sulfonylamino]propanamide (PubChem CID 55939114) has the molecular formula C21H35N3O5S and a molecular weight of 441.59 g/mol. Its IUPAC name is (2S)-N-(3-ethyl-2-morpholin-4-ylpentyl)-2-[(4-methoxyphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-(3-ethyl-2-morpholin-4-ylpentyl)-2-[(4-methoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55939114 |
| Molecular Formula | C21H35N3O5S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (2S)-N-(3-ethyl-2-morpholin-4-ylpentyl)-2-[(4-methoxyphenyl)sulfonylamino]propanamide |
| SMILES | CCC(CC)C(CNC(=O)[C@H](C)NS(=O)(=O)c1ccc(OC)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H35N3O5S/c1-5-17(6-2)20(24-11-13-29-14-12-24)15-22-21(25)16(3)23-30(26,27)19-9-7-18(28-4)8-10-19/h7-10,16-17,20,23H,5-6,11-15H2,1-4H3,(H,22,25)/t16-,20?/m0/s1 |
| InChIKey | GSNPFPHDTOGUMH-DJZRFWRSSA-N |
| XLogP | 1.62 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |