C21H31N3O3 — CID 134053073
2-(4-cyanophenoxy)-N-(3-ethyl-2-morpholin-4-ylpentyl)propanamide (PubChem CID 134053073) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-(3-ethyl-2-morpholin-4-ylpentyl)propanamide.
| Compound Name | 2-(4-cyanophenoxy)-N-(3-ethyl-2-morpholin-4-ylpentyl)propanamide |
|---|---|
| PubChem CID | 134053073 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-(3-ethyl-2-morpholin-4-ylpentyl)propanamide |
| SMILES | CCC(CC)C(CNC(=O)C(C)Oc1ccc(C#N)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H31N3O3/c1-4-18(5-2)20(24-10-12-26-13-11-24)15-23-21(25)16(3)27-19-8-6-17(14-22)7-9-19/h6-9,16,18,20H,4-5,10-13,15H2,1-3H3,(H,23,25) |
| InChIKey | MXSLQYKKHJXSSK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |