C13H14N2O5 — CID 107833675
(2S)-3-[2-(4-cyanophenoxy)propanoylamino]-2-hydroxypropanoic acid (PubChem CID 107833675) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is (2S)-3-[2-(4-cyanophenoxy)propanoylamino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[2-(4-cyanophenoxy)propanoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107833675 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (2S)-3-[2-(4-cyanophenoxy)propanoylamino]-2-hydroxypropanoic acid |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C13H14N2O5/c1-8(12(17)15-7-11(16)13(18)19)20-10-4-2-9(6-14)3-5-10/h2-5,8,11,16H,7H2,1H3,(H,15,17)(H,18,19)/t8?,11-/m0/s1 |
| InChIKey | LPANZGFSBYHSOA-LYNSQETBSA-N |
| XLogP | -0.11 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |