C14H16N2O5 — CID 107832580
4-[2-(4-cyanophenoxy)propanoylamino]-2-hydroxybutanoic acid (PubChem CID 107832580) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[2-(4-cyanophenoxy)propanoylamino]-2-hydroxybutanoic acid.
| Compound Name | 4-[2-(4-cyanophenoxy)propanoylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107832580 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[2-(4-cyanophenoxy)propanoylamino]-2-hydroxybutanoic acid |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C14H16N2O5/c1-9(13(18)16-7-6-12(17)14(19)20)21-11-4-2-10(8-15)3-5-11/h2-5,9,12,17H,6-7H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | FBWBOJMIAPSSIG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |