C21H32N4O2 — CID 38309492
1-[(1R)-1-(4-cyanophenyl)ethyl]-3-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]urea (PubChem CID 38309492) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-[(1R)-1-(4-cyanophenyl)ethyl]-3-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]urea.
| Compound Name | 1-[(1R)-1-(4-cyanophenyl)ethyl]-3-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]urea |
|---|---|
| PubChem CID | 38309492 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 1-[(1R)-1-(4-cyanophenyl)ethyl]-3-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]urea |
| SMILES | CCC(CC)[C@H](CNC(=O)N[C@H](C)c1ccc(C#N)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H32N4O2/c1-4-18(5-2)20(25-10-12-27-13-11-25)15-23-21(26)24-16(3)19-8-6-17(14-22)7-9-19/h6-9,16,18,20H,4-5,10-13,15H2,1-3H3,(H2,23,24,26)/t16-,20+/m1/s1 |
| InChIKey | IEZSCZZDGGSWJN-UZLBHIALSA-N |
| XLogP | 3.06 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |