C19H31N3O3 — CID 24665000
1-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methoxyphenyl)urea (PubChem CID 24665000) has the molecular formula C19H31N3O3 and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methoxyphenyl)urea.
| Compound Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 24665000 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methoxyphenyl)urea |
| SMILES | CCC(CC)C(CNC(=O)Nc1ccccc1OC)N1CCOCC1 |
| InChI | InChI=1S/C19H31N3O3/c1-4-15(5-2)17(22-10-12-25-13-11-22)14-20-19(23)21-16-8-6-7-9-18(16)24-3/h6-9,15,17H,4-5,10-14H2,1-3H3,(H2,20,21,23) |
| InChIKey | UJLAQKREHLQBHY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |