C22H36N2O4 — CID 46539482
3-(2,5-dimethoxyphenyl)-N-(3-ethyl-2-morpholin-4-ylpentyl)propanamide (PubChem CID 46539482) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-N-(3-ethyl-2-morpholin-4-ylpentyl)propanamide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-N-(3-ethyl-2-morpholin-4-ylpentyl)propanamide |
|---|---|
| PubChem CID | 46539482 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-N-(3-ethyl-2-morpholin-4-ylpentyl)propanamide |
| SMILES | CCC(CC)C(CNC(=O)CCc1cc(OC)ccc1OC)N1CCOCC1 |
| InChI | InChI=1S/C22H36N2O4/c1-5-17(6-2)20(24-11-13-28-14-12-24)16-23-22(25)10-7-18-15-19(26-3)8-9-21(18)27-4/h8-9,15,17,20H,5-7,10-14,16H2,1-4H3,(H,23,25) |
| InChIKey | CYZDQDKRVNEJGQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |