C16H35Cl2N3O2 — CID 119841667
N-(3-ethyl-2-morpholin-4-ylpentyl)-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119841667) has the molecular formula C16H35Cl2N3O2 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119841667 |
| Molecular Formula | C16H35Cl2N3O2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CCC(CC)C(CNC(=O)CCCNC)N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C16H33N3O2.2ClH/c1-4-14(5-2)15(19-9-11-21-12-10-19)13-18-16(20)7-6-8-17-3;;/h14-15,17H,4-13H2,1-3H3,(H,18,20);2*1H |
| InChIKey | PTLVSVHWUOQCSA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|