C19H37N3O3 — CID 55634041
6-acetamido-N-(3-ethyl-2-morpholin-4-ylpentyl)hexanamide (PubChem CID 55634041) has the molecular formula C19H37N3O3 and a molecular weight of 355.52 g/mol. Its IUPAC name is 6-acetamido-N-(3-ethyl-2-morpholin-4-ylpentyl)hexanamide.
| Compound Name | 6-acetamido-N-(3-ethyl-2-morpholin-4-ylpentyl)hexanamide |
|---|---|
| PubChem CID | 55634041 |
| Molecular Formula | C19H37N3O3 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.28 |
| IUPAC Name | 6-acetamido-N-(3-ethyl-2-morpholin-4-ylpentyl)hexanamide |
| SMILES | CCC(CC)C(CNC(=O)CCCCCNC(C)=O)N1CCOCC1 |
| InChI | InChI=1S/C19H37N3O3/c1-4-17(5-2)18(22-11-13-25-14-12-22)15-21-19(24)9-7-6-8-10-20-16(3)23/h17-18H,4-15H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | WDXLXFPYZPDULV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|