C22H35N3O4S — CID 55550446
N-(3-ethyl-2-morpholin-4-ylpentyl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide (PubChem CID 55550446) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55550446 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
| SMILES | CCC(CC)C(CNC(=O)CCNS(=O)(=O)/C=C/c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C22H35N3O4S/c1-3-20(4-2)21(25-13-15-29-16-14-25)18-23-22(26)10-12-24-30(27,28)17-11-19-8-6-5-7-9-19/h5-9,11,17,20-21,24H,3-4,10,12-16,18H2,1-2H3,(H,23,26)/b17-11+ |
| InChIKey | RUCCLLLDNYIKJN-GZTJUZNOSA-N |
| XLogP | 2.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |