C25H41N3O4S — CID 43049020
N-(3-ethyl-2-morpholin-4-ylpentyl)-3-(4-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 43049020) has the molecular formula C25H41N3O4S and a molecular weight of 479.69 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-3-(4-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 43049020 |
| Molecular Formula | C25H41N3O4S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CCC(CC)C(CNC(=O)CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C25H41N3O4S/c1-3-22(4-2)24(27-16-18-32-19-17-27)20-26-25(29)13-10-21-8-11-23(12-9-21)33(30,31)28-14-6-5-7-15-28/h8-9,11-12,22,24H,3-7,10,13-20H2,1-2H3,(H,26,29) |
| InChIKey | NMNOMRCVOIZZEV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |