C20H33N3O2 — CID 120595092
2-amino-N-(3-ethyl-2-morpholin-4-ylpentyl)-2-phenylpropanamide (PubChem CID 120595092) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-amino-N-(3-ethyl-2-morpholin-4-ylpentyl)-2-phenylpropanamide.
| Compound Name | 2-amino-N-(3-ethyl-2-morpholin-4-ylpentyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 120595092 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 2-amino-N-(3-ethyl-2-morpholin-4-ylpentyl)-2-phenylpropanamide |
| SMILES | CCC(CC)C(CNC(=O)C(C)(N)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H33N3O2/c1-4-16(5-2)18(23-11-13-25-14-12-23)15-22-19(24)20(3,21)17-9-7-6-8-10-17/h6-10,16,18H,4-5,11-15,21H2,1-3H3,(H,22,24) |
| InChIKey | NYUZJLXXRZWIHF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |