C22H33N3O3 — CID 46493943
1-[1-(1-benzofuran-2-yl)ethyl]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea (PubChem CID 46493943) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea |
|---|---|
| PubChem CID | 46493943 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea |
| SMILES | CCC(CC)C(CNC(=O)NC(C)c1cc2ccccc2o1)N1CCOCC1 |
| InChI | InChI=1S/C22H33N3O3/c1-4-17(5-2)19(25-10-12-27-13-11-25)15-23-22(26)24-16(3)21-14-18-8-6-7-9-20(18)28-21/h6-9,14,16-17,19H,4-5,10-13,15H2,1-3H3,(H2,23,24,26) |
| InChIKey | LRGHEJDAXVZQQQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |