C17H27BrN4O3S — CID 78887218
1-[(5-bromothiophene-2-carbonyl)amino]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea (PubChem CID 78887218) has the molecular formula C17H27BrN4O3S and a molecular weight of 447.40 g/mol. Its IUPAC name is 1-[(5-bromothiophene-2-carbonyl)amino]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea.
| Compound Name | 1-[(5-bromothiophene-2-carbonyl)amino]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea |
|---|---|
| PubChem CID | 78887218 |
| Molecular Formula | C17H27BrN4O3S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-[(5-bromothiophene-2-carbonyl)amino]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea |
| SMILES | CCC(CC)C(CNC(=O)NNC(=O)c1ccc(Br)s1)N1CCOCC1 |
| InChI | InChI=1S/C17H27BrN4O3S/c1-3-12(4-2)13(22-7-9-25-10-8-22)11-19-17(24)21-20-16(23)14-5-6-15(18)26-14/h5-6,12-13H,3-4,7-11H2,1-2H3,(H,20,23)(H2,19,21,24) |
| InChIKey | MPRBXDCHWHSWDX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|