C16H22ClF3N2O3S — CID 42938556
4-chloro-N-(3-methyl-2-morpholin-4-ylbutyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 42938556) has the molecular formula C16H22ClF3N2O3S and a molecular weight of 414.88 g/mol. Its IUPAC name is 4-chloro-N-(3-methyl-2-morpholin-4-ylbutyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(3-methyl-2-morpholin-4-ylbutyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42938556 |
| Molecular Formula | C16H22ClF3N2O3S |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 4-chloro-N-(3-methyl-2-morpholin-4-ylbutyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)C(CNS(=O)(=O)c1ccc(Cl)cc1C(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C16H22ClF3N2O3S/c1-11(2)14(22-5-7-25-8-6-22)10-21-26(23,24)15-4-3-12(17)9-13(15)16(18,19)20/h3-4,9,11,14,21H,5-8,10H2,1-2H3 |
| InChIKey | WCAITIGXCQKVEN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |