C12H15ClF3NO3S — CID 66109305
4-chloro-N-(4-hydroxy-2-methylbutyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 66109305) has the molecular formula C12H15ClF3NO3S and a molecular weight of 345.77 g/mol. Its IUPAC name is 4-chloro-N-(4-hydroxy-2-methylbutyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(4-hydroxy-2-methylbutyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66109305 |
| Molecular Formula | C12H15ClF3NO3S |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 4-chloro-N-(4-hydroxy-2-methylbutyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(CCO)CNS(=O)(=O)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15ClF3NO3S/c1-8(4-5-18)7-17-21(19,20)11-3-2-9(13)6-10(11)12(14,15)16/h2-3,6,8,17-18H,4-5,7H2,1H3 |
| InChIKey | DQUDBCJQGWNDPD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |