C9H11ClFNO3S — CID 43502351
3-chloro-4-fluoro-N-(2-hydroxypropyl)benzenesulfonamide (PubChem CID 43502351) has the molecular formula C9H11ClFNO3S and a molecular weight of 267.71 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(2-hydroxypropyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-(2-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43502351 |
| Molecular Formula | C9H11ClFNO3S |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 3-chloro-4-fluoro-N-(2-hydroxypropyl)benzenesulfonamide |
| SMILES | CC(O)CNS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H11ClFNO3S/c1-6(13)5-12-16(14,15)7-2-3-9(11)8(10)4-7/h2-4,6,12-13H,5H2,1H3 |
| InChIKey | GTQXTXNLAMWXNZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |