C9H11BrClNO2S — CID 114295767
N-(2-bromopropyl)-3-chlorobenzenesulfonamide (PubChem CID 114295767) has the molecular formula C9H11BrClNO2S and a molecular weight of 312.62 g/mol. Its IUPAC name is N-(2-bromopropyl)-3-chlorobenzenesulfonamide.
| Compound Name | N-(2-bromopropyl)-3-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 114295767 |
| Molecular Formula | C9H11BrClNO2S |
| Molecular Weight | 312.62 g/mol |
| Exact Mass | 310.94 |
| IUPAC Name | N-(2-bromopropyl)-3-chlorobenzenesulfonamide |
| SMILES | CC(Br)CNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H11BrClNO2S/c1-7(10)6-12-15(13,14)9-4-2-3-8(11)5-9/h2-5,7,12H,6H2,1H3 |
| InChIKey | ZCVFLAOHHPKDSG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.62 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|