C16H19ClN2O2S — CID 44903192
3-chloro-N-[2-(dimethylamino)-2-phenylethyl]benzenesulfonamide (PubChem CID 44903192) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 3-chloro-N-[2-(dimethylamino)-2-phenylethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-(dimethylamino)-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 44903192 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-chloro-N-[2-(dimethylamino)-2-phenylethyl]benzenesulfonamide |
| SMILES | CN(C)C(CNS(=O)(=O)c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-19(2)16(13-7-4-3-5-8-13)12-18-22(20,21)15-10-6-9-14(17)11-15/h3-11,16,18H,12H2,1-2H3 |
| InChIKey | LBLFRRJKJSKFGL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |