C18H21ClN2O4S — CID 124573264
methyl 2-chloro-4-[[(2S)-2-(dimethylamino)-2-phenylethyl]sulfamoyl]benzoate (PubChem CID 124573264) has the molecular formula C18H21ClN2O4S and a molecular weight of 396.90 g/mol. Its IUPAC name is methyl 2-chloro-4-[[(2S)-2-(dimethylamino)-2-phenylethyl]sulfamoyl]benzoate.
| Compound Name | methyl 2-chloro-4-[[(2S)-2-(dimethylamino)-2-phenylethyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 124573264 |
| Molecular Formula | C18H21ClN2O4S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | methyl 2-chloro-4-[[(2S)-2-(dimethylamino)-2-phenylethyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC[C@H](c2ccccc2)N(C)C)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O4S/c1-21(2)17(13-7-5-4-6-8-13)12-20-26(23,24)14-9-10-15(16(19)11-14)18(22)25-3/h4-11,17,20H,12H2,1-3H3/t17-/m1/s1 |
| InChIKey | KVLRJGQACPEMSX-QGZVFWFLSA-N |
| XLogP | 2.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |