C14H15ClN2O4S2 — CID 124618800
methyl 2-chloro-4-[[(2S)-2-(1,3-thiazol-2-yl)propyl]sulfamoyl]benzoate (PubChem CID 124618800) has the molecular formula C14H15ClN2O4S2 and a molecular weight of 374.87 g/mol. Its IUPAC name is methyl 2-chloro-4-[[(2S)-2-(1,3-thiazol-2-yl)propyl]sulfamoyl]benzoate.
| Compound Name | methyl 2-chloro-4-[[(2S)-2-(1,3-thiazol-2-yl)propyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 124618800 |
| Molecular Formula | C14H15ClN2O4S2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | methyl 2-chloro-4-[[(2S)-2-(1,3-thiazol-2-yl)propyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC[C@H](C)c2nccs2)cc1Cl |
| InChI | InChI=1S/C14H15ClN2O4S2/c1-9(13-16-5-6-22-13)8-17-23(19,20)10-3-4-11(12(15)7-10)14(18)21-2/h3-7,9,17H,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | FNOAZMYYODHUKG-VIFPVBQESA-N |
| XLogP | 2.67 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |