C12H12ClN3OS — CID 104578800
3-chloro-N-[2-(1,3-thiazol-2-yl)propyl]pyridine-4-carboxamide (PubChem CID 104578800) has the molecular formula C12H12ClN3OS and a molecular weight of 281.77 g/mol. Its IUPAC name is 3-chloro-N-[2-(1,3-thiazol-2-yl)propyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[2-(1,3-thiazol-2-yl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 104578800 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 3-chloro-N-[2-(1,3-thiazol-2-yl)propyl]pyridine-4-carboxamide |
| SMILES | CC(CNC(=O)c1ccncc1Cl)c1nccs1 |
| InChI | InChI=1S/C12H12ClN3OS/c1-8(12-15-4-5-18-12)6-16-11(17)9-2-3-14-7-10(9)13/h2-5,7-8H,6H2,1H3,(H,16,17) |
| InChIKey | FUQOMUDFEFYSCA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |