C11H12ClN3S — CID 104577268
3-chloro-N-[2-(1,3-thiazol-2-yl)propyl]pyridin-4-amine (PubChem CID 104577268) has the molecular formula C11H12ClN3S and a molecular weight of 253.76 g/mol. Its IUPAC name is 3-chloro-N-[2-(1,3-thiazol-2-yl)propyl]pyridin-4-amine.
| Compound Name | 3-chloro-N-[2-(1,3-thiazol-2-yl)propyl]pyridin-4-amine |
|---|---|
| PubChem CID | 104577268 |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.76 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-chloro-N-[2-(1,3-thiazol-2-yl)propyl]pyridin-4-amine |
| SMILES | CC(CNc1ccncc1Cl)c1nccs1 |
| InChI | InChI=1S/C11H12ClN3S/c1-8(11-14-4-5-16-11)6-15-10-2-3-13-7-9(10)12/h2-5,7-8H,6H2,1H3,(H,13,15) |
| InChIKey | AUXZTRXRFGQDIN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |