C10H15ClN2 — CID 79769796
3-chloro-N-(3-methylbutyl)pyridin-4-amine (PubChem CID 79769796) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 3-chloro-N-(3-methylbutyl)pyridin-4-amine.
| Compound Name | 3-chloro-N-(3-methylbutyl)pyridin-4-amine |
|---|---|
| PubChem CID | 79769796 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-chloro-N-(3-methylbutyl)pyridin-4-amine |
| SMILES | CC(C)CCNc1ccncc1Cl |
| InChI | InChI=1S/C10H15ClN2/c1-8(2)3-6-13-10-4-5-12-7-9(10)11/h4-5,7-8H,3,6H2,1-2H3,(H,12,13) |
| InChIKey | ZLOKFQKEHQROEY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |