C11H18ClN3 — CID 106155235
N'-(3-chloro-4-pyridinyl)-2-methylpentane-1,5-diamine (PubChem CID 106155235) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is N'-(3-chloro-4-pyridinyl)-2-methylpentane-1,5-diamine.
| Compound Name | N'-(3-chloro-4-pyridinyl)-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 106155235 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N'-(3-chloro-4-pyridinyl)-2-methylpentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1ccncc1Cl |
| InChI | InChI=1S/C11H18ClN3/c1-9(7-13)3-2-5-15-11-4-6-14-8-10(11)12/h4,6,8-9H,2-3,5,7,13H2,1H3,(H,14,15) |
| InChIKey | DQUFZPKKDPIKIF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|