C13H12FN3S — CID 104577319
2-fluoro-6-[2-(1,3-thiazol-2-yl)propylamino]benzonitrile (PubChem CID 104577319) has the molecular formula C13H12FN3S and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-fluoro-6-[2-(1,3-thiazol-2-yl)propylamino]benzonitrile.
| Compound Name | 2-fluoro-6-[2-(1,3-thiazol-2-yl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 104577319 |
| Molecular Formula | C13H12FN3S |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-fluoro-6-[2-(1,3-thiazol-2-yl)propylamino]benzonitrile |
| SMILES | CC(CNc1cccc(F)c1C#N)c1nccs1 |
| InChI | InChI=1S/C13H12FN3S/c1-9(13-16-5-6-18-13)8-17-12-4-2-3-11(14)10(12)7-15/h2-6,9,17H,8H2,1H3 |
| InChIKey | IGYUFERVYBOHNW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |