C15H16FN5OS — CID 95612502
1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[(1S)-1-(1,3-thiazol-2-yl)ethyl]urea (PubChem CID 95612502) has the molecular formula C15H16FN5OS and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[(1S)-1-(1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[(1S)-1-(1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 95612502 |
| Molecular Formula | C15H16FN5OS |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[(1S)-1-(1,3-thiazol-2-yl)ethyl]urea |
| SMILES | C[C@H](NC(=O)NCCNc1cccc(F)c1C#N)c1nccs1 |
| InChI | InChI=1S/C15H16FN5OS/c1-10(14-19-7-8-23-14)21-15(22)20-6-5-18-13-4-2-3-12(16)11(13)9-17/h2-4,7-8,10,18H,5-6H2,1H3,(H2,20,21,22)/t10-/m0/s1 |
| InChIKey | HNMWDLDREIQMBS-JTQLQIEISA-N |
| XLogP | 2.63 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|