C22H19FN4O2S — CID 55753887
N-[2-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]phenyl]-N-methylthiophene-2-carboxamide (PubChem CID 55753887) has the molecular formula C22H19FN4O2S and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[2-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]phenyl]-N-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]phenyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55753887 |
| Molecular Formula | C22H19FN4O2S |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[2-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]phenyl]-N-methylthiophene-2-carboxamide |
| SMILES | CN(C(=O)c1cccs1)c1ccccc1C(=O)NCCNc1cccc(F)c1C#N |
| InChI | InChI=1S/C22H19FN4O2S/c1-27(22(29)20-10-5-13-30-20)19-9-3-2-6-15(19)21(28)26-12-11-25-18-8-4-7-17(23)16(18)14-24/h2-10,13,25H,11-12H2,1H3,(H,26,28) |
| InChIKey | DCXWDZWLJXNUIH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|