C16H13FIN3O — CID 55753853
N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-iodobenzamide (PubChem CID 55753853) has the molecular formula C16H13FIN3O and a molecular weight of 409.20 g/mol. Its IUPAC name is N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-iodobenzamide.
| Compound Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 55753853 |
| Molecular Formula | C16H13FIN3O |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-iodobenzamide |
| SMILES | N#Cc1c(F)cccc1NCCNC(=O)c1ccccc1I |
| InChI | InChI=1S/C16H13FIN3O/c17-13-5-3-7-15(12(13)10-19)20-8-9-21-16(22)11-4-1-2-6-14(11)18/h1-7,20H,8-9H2,(H,21,22) |
| InChIKey | DQDVISUZLBUYBA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|