C23H19FN4O3 — CID 56549005
4-[4-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]phenoxy]benzamide (PubChem CID 56549005) has the molecular formula C23H19FN4O3 and a molecular weight of 418.43 g/mol. Its IUPAC name is 4-[4-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56549005 |
| Molecular Formula | C23H19FN4O3 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-[4-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]phenoxy]benzamide |
| SMILES | N#Cc1c(F)cccc1NCCNC(=O)c1ccc(Oc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C23H19FN4O3/c24-20-2-1-3-21(19(20)14-25)27-12-13-28-23(30)16-6-10-18(11-7-16)31-17-8-4-15(5-9-17)22(26)29/h1-11,27H,12-13H2,(H2,26,29)(H,28,30) |
| InChIKey | BJGRNKSKGGJRRM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 117.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|