C22H21FN4O2S — CID 55843470
N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 55843470) has the molecular formula C22H21FN4O2S and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 55843470 |
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCOc1ccc(-c2nc(CC(=O)NCCNc3cccc(F)c3C#N)cs2)cc1 |
| InChI | InChI=1S/C22H21FN4O2S/c1-2-29-17-8-6-15(7-9-17)22-27-16(14-30-22)12-21(28)26-11-10-25-20-5-3-4-19(23)18(20)13-24/h3-9,14,25H,2,10-12H2,1H3,(H,26,28) |
| InChIKey | WFMLJPVALFANBU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|